C31H35Cl2N7 — CID 151307985
5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclopropylindol-3-yl)pyrimidin-2-amine (PubChem CID 151307985) has the molecular formula C31H35Cl2N7 and a molecular weight of 576.58 g/mol. Its IUPAC name is 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclopropylindol-3-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclopropylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 151307985 |
| Molecular Formula | C31H35Cl2N7 |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclopropylindol-3-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc(Cl)c(-c5cn(C6CC6)c6ccccc56)n4)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C31H35Cl2N7/c1-37-14-16-38(17-15-37)22-10-12-39(13-11-22)29-9-6-21(18-26(29)32)35-31-34-19-27(33)30(36-31)25-20-40(23-7-8-23)28-5-3-2-4-24(25)28/h2-6,9,18-20,22-23H,7-8,10-17H2,1H3,(H,34,35,36) |
| InChIKey | ODUZEUSHVKKCOV-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|