C27H30Cl2N8 — CID 148816833
4-(benzimidazol-1-yl)-5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidin-2-amine (PubChem CID 148816833) has the molecular formula C27H30Cl2N8 and a molecular weight of 537.50 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidin-2-amine.
| Compound Name | 4-(benzimidazol-1-yl)-5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 148816833 |
| Molecular Formula | C27H30Cl2N8 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4-(benzimidazol-1-yl)-5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc(Cl)c(-n5cnc6ccccc65)n4)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C27H30Cl2N8/c1-34-12-14-35(15-13-34)20-8-10-36(11-9-20)24-7-6-19(16-21(24)28)32-27-30-17-22(29)26(33-27)37-18-31-23-4-2-3-5-25(23)37/h2-7,16-18,20H,8-15H2,1H3,(H,30,32,33) |
| InChIKey | OQZNQIILDUIIQH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 65.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|