C34H41Cl2N7OS — CID 154934172
5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclohexylsulfinylindol-3-yl)pyrimidin-2-amine (PubChem CID 154934172) has the molecular formula C34H41Cl2N7OS and a molecular weight of 666.72 g/mol. Its IUPAC name is 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclohexylsulfinylindol-3-yl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclohexylsulfinylindol-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 154934172 |
| Molecular Formula | C34H41Cl2N7OS |
| Molecular Weight | 666.72 g/mol |
| Exact Mass | 665.25 |
| IUPAC Name | 5-chloro-N-[3-chloro-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-(1-cyclohexylsulfinylindol-3-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc(Cl)c(-c5cn(S(=O)C6CCCCC6)c6ccccc56)n4)cc3Cl)CC2)CC1 |
| InChI | InChI=1S/C34H41Cl2N7OS/c1-40-17-19-41(20-18-40)25-13-15-42(16-14-25)32-12-11-24(21-29(32)35)38-34-37-22-30(36)33(39-34)28-23-43(31-10-6-5-9-27(28)31)45(44)26-7-3-2-4-8-26/h5-6,9-12,21-23,25-26H,2-4,7-8,13-20H2,1H3,(H,37,38,39) |
| InChIKey | RXZJQUFWDJRKFW-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.72 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|