C13H12ClN5 — CID 80853710
4-(benzimidazol-1-yl)-5-chloro-N-ethylpyrimidin-2-amine (PubChem CID 80853710) has the molecular formula C13H12ClN5 and a molecular weight of 273.73 g/mol. Its IUPAC name is 4-(benzimidazol-1-yl)-5-chloro-N-ethylpyrimidin-2-amine.
| Compound Name | 4-(benzimidazol-1-yl)-5-chloro-N-ethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80853710 |
| Molecular Formula | C13H12ClN5 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-(benzimidazol-1-yl)-5-chloro-N-ethylpyrimidin-2-amine |
| SMILES | CCNc1ncc(Cl)c(-n2cnc3ccccc32)n1 |
| InChI | InChI=1S/C13H12ClN5/c1-2-15-13-16-7-9(14)12(18-13)19-8-17-10-5-3-4-6-11(10)19/h3-8H,2H2,1H3,(H,15,16,18) |
| InChIKey | JAGHEPPPNYDFGV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |