C14H12Cl2N4 — CID 102760242
6-(benzimidazol-1-yl)-3,5-dichloro-N-ethylpyridin-2-amine (PubChem CID 102760242) has the molecular formula C14H12Cl2N4 and a molecular weight of 307.18 g/mol. Its IUPAC name is 6-(benzimidazol-1-yl)-3,5-dichloro-N-ethylpyridin-2-amine.
| Compound Name | 6-(benzimidazol-1-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 102760242 |
| Molecular Formula | C14H12Cl2N4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-(benzimidazol-1-yl)-3,5-dichloro-N-ethylpyridin-2-amine |
| SMILES | CCNc1nc(-n2cnc3ccccc32)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N4/c1-2-17-13-9(15)7-10(16)14(19-13)20-8-18-11-5-3-4-6-12(11)20/h3-8H,2H2,1H3,(H,17,19) |
| InChIKey | JTHZYIJGQIEJJG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |