C29H38N8O4 — CID 144980998
1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-[(E)-1-(2-ethylphenyl)prop-1-enyl]pyrimidin-5-yl]-3-methylurea (PubChem CID 144980998) has the molecular formula C29H38N8O4 and a molecular weight of 562.68 g/mol. Its IUPAC name is 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-[(E)-1-(2-ethylphenyl)prop-1-enyl]pyrimidin-5-yl]-3-methylurea.
| Compound Name | 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-[(E)-1-(2-ethylphenyl)prop-1-enyl]pyrimidin-5-yl]-3-methylurea |
|---|---|
| PubChem CID | 144980998 |
| Molecular Formula | C29H38N8O4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 1-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-4-[(E)-1-(2-ethylphenyl)prop-1-enyl]pyrimidin-5-yl]-3-methylurea |
| SMILES | C/C=C(\c1ccccc1CC)c1nc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)ncc1NC(=O)NC |
| InChI | InChI=1S/C29H38N8O4/c1-8-19-12-10-11-13-21(19)20(9-2)27-23(33-29(38)30-3)18-31-28(34-27)32-22-16-25(37(39)40)24(17-26(22)41-7)36(6)15-14-35(4)5/h9-13,16-18H,8,14-15H2,1-7H3,(H2,30,33,38)(H,31,32,34)/b20-9+ |
| InChIKey | SVKFQKUPHMXRBO-AWQFTUOYSA-N |
| XLogP | 4.90 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|