C31H41N7O4 — CID 155176386
(2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-N,3-dimethylpentanamide (PubChem CID 155176386) has the molecular formula C31H41N7O4 and a molecular weight of 575.71 g/mol. Its IUPAC name is (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-N,3-dimethylpentanamide.
| Compound Name | (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 155176386 |
| Molecular Formula | C31H41N7O4 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-N,3-dimethylpentanamide |
| SMILES | CCC(C)/C(C(=O)NC)=C(/c1ccnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)n1)c1ccccc1C |
| InChI | InChI=1S/C31H41N7O4/c1-9-20(2)28(30(39)32-4)29(22-13-11-10-12-21(22)3)23-14-15-33-31(34-23)35-24-18-26(38(40)41)25(19-27(24)42-8)37(7)17-16-36(5)6/h10-15,18-20H,9,16-17H2,1-8H3,(H,32,39)(H,33,34,35)/b29-28- |
| InChIKey | PNSZDZNCSFUBTB-ZIADKAODSA-N |
| XLogP | 5.04 |
| TPSA | 125.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|