C30H37N7O3 — CID 144980954
(2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-3-methylpentanenitrile (PubChem CID 144980954) has the molecular formula C30H37N7O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-3-methylpentanenitrile.
| Compound Name | (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-3-methylpentanenitrile |
|---|---|
| PubChem CID | 144980954 |
| Molecular Formula | C30H37N7O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | (2Z)-2-[[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-(2-methylphenyl)methylidene]-3-methylpentanenitrile |
| SMILES | CCC(C)/C(C#N)=C(/c1ccnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)n1)c1ccccc1C |
| InChI | InChI=1S/C30H37N7O3/c1-8-20(2)23(19-31)29(22-12-10-9-11-21(22)3)24-13-14-32-30(33-24)34-25-17-27(37(38)39)26(18-28(25)40-7)36(6)16-15-35(4)5/h9-14,17-18,20H,8,15-16H2,1-7H3,(H,32,33,34)/b29-23+ |
| InChIKey | OSDFFXYUOOEFNQ-BYNJWEBRSA-N |
| XLogP | 5.81 |
| TPSA | 120.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|