C21H30N6O3 — CID 145177337
4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[4-[(Z)-pent-3-enyl]pyrimidin-2-yl]benzene-1,4-diamine (PubChem CID 145177337) has the molecular formula C21H30N6O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[4-[(Z)-pent-3-enyl]pyrimidin-2-yl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[4-[(Z)-pent-3-enyl]pyrimidin-2-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 145177337 |
| Molecular Formula | C21H30N6O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitro-1-N-[4-[(Z)-pent-3-enyl]pyrimidin-2-yl]benzene-1,4-diamine |
| SMILES | C/C=C\CCc1ccnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)n1 |
| InChI | InChI=1S/C21H30N6O3/c1-6-7-8-9-16-10-11-22-21(23-16)24-17-14-19(27(28)29)18(15-20(17)30-5)26(4)13-12-25(2)3/h6-7,10-11,14-15H,8-9,12-13H2,1-5H3,(H,22,23,24)/b7-6- |
| InChIKey | DMNGDASYMUXQLU-SREVYHEPSA-N |
| XLogP | 3.64 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|