C25H28N8O4 — CID 171500385
2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methyl-6-pyridin-4-ylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171500385) has the molecular formula C25H28N8O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methyl-6-pyridin-4-ylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methyl-6-pyridin-4-ylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171500385 |
| Molecular Formula | C25H28N8O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methyl-6-pyridin-4-ylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc2cc(-c3ccncc3)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C25H28N8O4/c1-30(2)10-11-31(3)20-14-22(37-5)19(13-21(20)33(35)36)28-25-27-15-17-12-18(16-6-8-26-9-7-16)24(34)32(4)23(17)29-25/h6-9,12-15H,10-11H2,1-5H3,(H,27,28,29) |
| InChIKey | SCCBCRPWMKSULJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|