C20H24BrN7O4 — CID 171500377
6-bromo-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 171500377) has the molecular formula C20H24BrN7O4 and a molecular weight of 506.36 g/mol. Its IUPAC name is 6-bromo-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 171500377 |
| Molecular Formula | C20H24BrN7O4 |
| Molecular Weight | 506.36 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 6-bromo-2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]-8-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1ncc2cc(Br)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C20H24BrN7O4/c1-25(2)6-7-26(3)15-10-17(32-5)14(9-16(15)28(30)31)23-20-22-11-12-8-13(21)19(29)27(4)18(12)24-20/h8-11H,6-7H2,1-5H3,(H,22,23,24) |
| InChIKey | CYIBWSIXAZYCES-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 118.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|