C26H27N9O3 — CID 178172975
4-[2-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-5-yl]benzonitrile (PubChem CID 178172975) has the molecular formula C26H27N9O3 and a molecular weight of 513.56 g/mol. Its IUPAC name is 4-[2-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-5-yl]benzonitrile.
| Compound Name | 4-[2-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 178172975 |
| Molecular Formula | C26H27N9O3 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[2-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-5-yl]benzonitrile |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2ncc(-c3ccc(C#N)cc3)[nH]2)n1 |
| InChI | InChI=1S/C26H27N9O3/c1-33(2)11-12-34(3)22-14-24(38-4)20(13-23(22)35(36)37)32-26-28-10-9-19(31-26)25-29-16-21(30-25)18-7-5-17(15-27)6-8-18/h5-10,13-14,16H,11-12H2,1-4H3,(H,29,30)(H,28,31,32) |
| InChIKey | YBRCPQMDAYCUCS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|