C28H33ClN8O4 — CID 154633188
3-[4-(4-chlorophenyl)-5-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-2-yl]propan-1-ol (PubChem CID 154633188) has the molecular formula C28H33ClN8O4 and a molecular weight of 581.08 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-5-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-2-yl]propan-1-ol.
| Compound Name | 3-[4-(4-chlorophenyl)-5-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 154633188 |
| Molecular Formula | C28H33ClN8O4 |
| Molecular Weight | 581.08 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-5-[2-[4-[2-(dimethylamino)ethyl-methylamino]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]-1H-imidazol-2-yl]propan-1-ol |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])cc1Nc1nccc(-c2[nH]c(CCCO)nc2-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C28H33ClN8O4/c1-35(2)13-14-36(3)22-17-24(41-4)21(16-23(22)37(39)40)32-28-30-12-11-20(31-28)27-26(18-7-9-19(29)10-8-18)33-25(34-27)6-5-15-38/h7-12,16-17,38H,5-6,13-15H2,1-4H3,(H,33,34)(H,30,31,32) |
| InChIKey | UOXCJCLGOWONGP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 145.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|