C23H25F2N7O4 — CID 137103884
2-[2-[2-(difluoromethoxy)-4-[2-(dimethylamino)ethyl-methylamino]-5-nitroanilino]pyrimidine-4-carboximidoyl]phenol (PubChem CID 137103884) has the molecular formula C23H25F2N7O4 and a molecular weight of 501.49 g/mol. Its IUPAC name is 2-[2-[2-(difluoromethoxy)-4-[2-(dimethylamino)ethyl-methylamino]-5-nitroanilino]pyrimidine-4-carboximidoyl]phenol.
| Compound Name | 2-[2-[2-(difluoromethoxy)-4-[2-(dimethylamino)ethyl-methylamino]-5-nitroanilino]pyrimidine-4-carboximidoyl]phenol |
|---|---|
| PubChem CID | 137103884 |
| Molecular Formula | C23H25F2N7O4 |
| Molecular Weight | 501.49 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[2-[2-(difluoromethoxy)-4-[2-(dimethylamino)ethyl-methylamino]-5-nitroanilino]pyrimidine-4-carboximidoyl]phenol |
| SMILES | [H]/N=C(/c1ccnc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC(F)F)n1)c1ccccc1O |
| InChI | InChI=1S/C23H25F2N7O4/c1-30(2)10-11-31(3)17-13-20(36-22(24)25)16(12-18(17)32(34)35)29-23-27-9-8-15(28-23)21(26)14-6-4-5-7-19(14)33/h4-9,12-13,22,26,33H,10-11H2,1-3H3,(H,27,28,29)/b26-21+ |
| InChIKey | WCWFXSIITIQIHA-YYADALCUSA-N |
| XLogP | 3.85 |
| TPSA | 140.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|