C30H37N7O2 — CID 130208414
propan-2-yl 2-[5-amino-2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]anilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate (PubChem CID 130208414) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is propan-2-yl 2-[5-amino-2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]anilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 2-[5-amino-2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]anilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 130208414 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | propan-2-yl 2-[5-amino-2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]anilino]-4-(1H-indol-3-yl)pyrimidine-5-carboxylate |
| SMILES | Cc1cc(N(C)C[C@H]2CCCN2C)c(N)cc1Nc1ncc(C(=O)OC(C)C)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C30H37N7O2/c1-18(2)39-29(38)23-16-33-30(35-28(23)22-15-32-25-11-7-6-10-21(22)25)34-26-14-24(31)27(13-19(26)3)37(5)17-20-9-8-12-36(20)4/h6-7,10-11,13-16,18,20,32H,8-9,12,17,31H2,1-5H3,(H,33,34,35)/t20-/m1/s1 |
| InChIKey | OSBQDVBZJJVKMP-HXUWFJFHSA-N |
| XLogP | 5.35 |
| TPSA | 112.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|