C33H39N7O3 — CID 130208468
ethyl 4-(1-methylindol-3-yl)-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-(prop-2-enoylamino)anilino]pyrimidine-5-carboxylate (PubChem CID 130208468) has the molecular formula C33H39N7O3 and a molecular weight of 581.72 g/mol. Its IUPAC name is ethyl 4-(1-methylindol-3-yl)-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-(prop-2-enoylamino)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(1-methylindol-3-yl)-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-(prop-2-enoylamino)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 130208468 |
| Molecular Formula | C33H39N7O3 |
| Molecular Weight | 581.72 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | ethyl 4-(1-methylindol-3-yl)-2-[2-methyl-4-[methyl-[[(2R)-1-methylpyrrolidin-2-yl]methyl]amino]-5-(prop-2-enoylamino)anilino]pyrimidine-5-carboxylate |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C(=O)OCC)c(-c3cn(C)c4ccccc34)n2)c(C)cc1N(C)C[C@H]1CCCN1C |
| InChI | InChI=1S/C33H39N7O3/c1-7-30(41)35-27-17-26(21(3)16-29(27)39(5)19-22-12-11-15-38(22)4)36-33-34-18-24(32(42)43-8-2)31(37-33)25-20-40(6)28-14-10-9-13-23(25)28/h7,9-10,13-14,16-18,20,22H,1,8,11-12,15,19H2,2-6H3,(H,35,41)(H,34,36,37)/t22-/m1/s1 |
| InChIKey | JPGOJJLTKHEIJG-JOCHJYFZSA-N |
| XLogP | 5.52 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|