C35H39N7O4 — CID 155324270
propan-2-yl 2-[4-[(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-methoxy-5-(prop-2-enoylamino)anilino]-4-(1-cyclopropylindol-3-yl)pyrimidine-5-carboxylate (PubChem CID 155324270) has the molecular formula C35H39N7O4 and a molecular weight of 621.74 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-methoxy-5-(prop-2-enoylamino)anilino]-4-(1-cyclopropylindol-3-yl)pyrimidine-5-carboxylate.
| Compound Name | propan-2-yl 2-[4-[(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-methoxy-5-(prop-2-enoylamino)anilino]-4-(1-cyclopropylindol-3-yl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155324270 |
| Molecular Formula | C35H39N7O4 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | propan-2-yl 2-[4-[(3aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-methoxy-5-(prop-2-enoylamino)anilino]-4-(1-cyclopropylindol-3-yl)pyrimidine-5-carboxylate |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(C(=O)OC(C)C)c(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1N1CC2CNC[C@@H]2C1 |
| InChI | InChI=1S/C35H39N7O4/c1-5-32(43)38-27-12-28(31(45-4)13-30(27)41-17-21-14-36-15-22(21)18-41)39-35-37-16-25(34(44)46-20(2)3)33(40-35)26-19-42(23-10-11-23)29-9-7-6-8-24(26)29/h5-9,12-13,16,19-23,36H,1,10-11,14-15,17-18H2,2-4H3,(H,38,43)(H,37,39,40)/t21-,22?/m1/s1 |
| InChIKey | AFXSXXIKURITJJ-ZMFCMNQTSA-N |
| XLogP | 5.53 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|