C34H40N7O3P — CID 167008371
N-[5-[[4-(1-cyclopropylindol-3-yl)-5-dimethylphosphorylpyrimidin-2-yl]amino]-4-methoxy-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]prop-2-enamide (PubChem CID 167008371) has the molecular formula C34H40N7O3P and a molecular weight of 625.71 g/mol. Its IUPAC name is N-[5-[[4-(1-cyclopropylindol-3-yl)-5-dimethylphosphorylpyrimidin-2-yl]amino]-4-methoxy-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]prop-2-enamide.
| Compound Name | N-[5-[[4-(1-cyclopropylindol-3-yl)-5-dimethylphosphorylpyrimidin-2-yl]amino]-4-methoxy-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 167008371 |
| Molecular Formula | C34H40N7O3P |
| Molecular Weight | 625.71 g/mol |
| Exact Mass | 625.29 |
| IUPAC Name | N-[5-[[4-(1-cyclopropylindol-3-yl)-5-dimethylphosphorylpyrimidin-2-yl]amino]-4-methoxy-2-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(P(C)(C)=O)c(-c3cn(C4CC4)c4ccccc34)n2)c(OC)cc1N1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C34H40N7O3P/c1-6-32(42)36-26-13-27(30(44-3)14-29(26)40-18-21-16-39(2)17-22(21)19-40)37-34-35-15-31(45(4,5)43)33(38-34)25-20-41(23-11-12-23)28-10-8-7-9-24(25)28/h6-10,13-15,20-23H,1,11-12,16-19H2,2-5H3,(H,36,42)(H,35,37,38) |
| InChIKey | YSCLJUYZHMMGHZ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.71 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|