C34H27FN8O7 — CID 168871166
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[5-methoxy-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-nitroanilino]methyl]isoindole-1,3-dione (PubChem CID 168871166) has the molecular formula C34H27FN8O7 and a molecular weight of 678.64 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[5-methoxy-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-nitroanilino]methyl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[5-methoxy-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-nitroanilino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168871166 |
| Molecular Formula | C34H27FN8O7 |
| Molecular Weight | 678.64 g/mol |
| Exact Mass | 678.20 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-[[5-methoxy-4-[[4-(1-methylindol-3-yl)pyrimidin-2-yl]amino]-2-nitroanilino]methyl]isoindole-1,3-dione |
| SMILES | COc1cc(NCc2cc3c(cc2F)C(=O)N(C2CCC(=O)NC2=O)C3=O)c([N+](=O)[O-])cc1Nc1nccc(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C34H27FN8O7/c1-41-16-21(18-5-3-4-6-26(18)41)23-9-10-36-34(38-23)39-25-13-28(43(48)49)24(14-29(25)50-2)37-15-17-11-19-20(12-22(17)35)33(47)42(32(19)46)27-7-8-30(44)40-31(27)45/h3-6,9-14,16,27,37H,7-8,15H2,1-2H3,(H,36,38,39)(H,40,44,45) |
| InChIKey | FVMYQNBVYVUOLX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 190.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|