C34H41N7O2 — CID 155528259
5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenyl-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 155528259) has the molecular formula C34H41N7O2 and a molecular weight of 579.75 g/mol. Its IUPAC name is 5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenyl-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenyl-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 155528259 |
| Molecular Formula | C34H41N7O2 |
| Molecular Weight | 579.75 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | 5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-6-phenyl-8-[(3R)-1-propanoylpiperidin-3-yl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCC(=O)N1CCC[C@@H](n2c(=O)c(-c3ccccc3)c(C)c3cnc(Nc4ccc(N5CCN(C)CC5)c(C)c4)nc32)C1 |
| InChI | InChI=1S/C34H41N7O2/c1-5-30(42)40-15-9-12-27(22-40)41-32-28(24(3)31(33(41)43)25-10-7-6-8-11-25)21-35-34(37-32)36-26-13-14-29(23(2)20-26)39-18-16-38(4)17-19-39/h6-8,10-11,13-14,20-21,27H,5,9,12,15-19,22H2,1-4H3,(H,35,36,37)/t27-/m1/s1 |
| InChIKey | FZFBDQZLVGZMJL-HHHXNRCGSA-N |
| XLogP | 5.14 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|