C36H41ClN6O2 — CID 166628959
8-(1-adamantyl)-6-(2-chlorophenyl)-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 166628959) has the molecular formula C36H41ClN6O2 and a molecular weight of 625.22 g/mol. Its IUPAC name is 8-(1-adamantyl)-6-(2-chlorophenyl)-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(1-adamantyl)-6-(2-chlorophenyl)-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166628959 |
| Molecular Formula | C36H41ClN6O2 |
| Molecular Weight | 625.22 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | 8-(1-adamantyl)-6-(2-chlorophenyl)-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | COc1cc(Nc2ncc3c(C)c(-c4ccccc4Cl)c(=O)n(C45CC6CC(CC(C6)C4)C5)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C36H41ClN6O2/c1-22-28-21-38-35(39-26-8-9-30(31(17-26)45-3)42-12-10-41(2)11-13-42)40-33(28)43(34(44)32(22)27-6-4-5-7-29(27)37)36-18-23-14-24(19-36)16-25(15-23)20-36/h4-9,17,21,23-25H,10-16,18-20H2,1-3H3,(H,38,39,40) |
| InChIKey | CSFQFUQLLZPPHS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.22 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|