C30H31N9O — CID 90768413
17-(4-methyl-3,4-dihydropyridin-6-yl)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 90768413) has the molecular formula C30H31N9O and a molecular weight of 533.64 g/mol. Its IUPAC name is 17-(4-methyl-3,4-dihydropyridin-6-yl)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 17-(4-methyl-3,4-dihydropyridin-6-yl)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 90768413 |
| Molecular Formula | C30H31N9O |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.27 |
| IUPAC Name | 17-(4-methyl-3,4-dihydropyridin-6-yl)-6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | Cc1cc(Nc2ncc3c(=O)n4c(nc3n2)c2ccccc2n4C2=CC(C)CC=N2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C30H31N9O/c1-19-10-11-31-26(16-19)38-25-7-5-4-6-22(25)28-34-27-23(29(40)39(28)38)18-32-30(35-27)33-21-8-9-24(20(2)17-21)37-14-12-36(3)13-15-37/h4-9,11,16-19H,10,12-15H2,1-3H3,(H,32,33,35) |
| InChIKey | IESDVIJXCMIGPI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|