C30H30N10O — CID 67608102
6-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 67608102) has the molecular formula C30H30N10O and a molecular weight of 546.64 g/mol. Its IUPAC name is 6-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 67608102 |
| Molecular Formula | C30H30N10O |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 6-[4-[(3R)-4-methyl-3-propan-2-ylpiperazin-1-yl]anilino]-17-pyrimidin-2-yl-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | CC(C)[C@@H]1CN(c2ccc(Nc3ncc4c(=O)n5c(nc4n3)c3ccccc3n5-c3ncccn3)cc2)CCN1C |
| InChI | InChI=1S/C30H30N10O/c1-19(2)25-18-38(16-15-37(25)3)21-11-9-20(10-12-21)34-29-33-17-23-26(36-29)35-27-22-7-4-5-8-24(22)39(40(27)28(23)41)30-31-13-6-14-32-30/h4-14,17,19,25H,15-16,18H2,1-3H3,(H,33,34,36)/t25-/m0/s1 |
| InChIKey | LRERKEWGHUCCTD-VWLOTQADSA-N |
| XLogP | 3.89 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|