C30H29N9O — CID 67606941
6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-(5-methyl-2-pyridinyl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one (PubChem CID 67606941) has the molecular formula C30H29N9O and a molecular weight of 531.62 g/mol. Its IUPAC name is 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-(5-methyl-2-pyridinyl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one.
| Compound Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-(5-methyl-2-pyridinyl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
|---|---|
| PubChem CID | 67606941 |
| Molecular Formula | C30H29N9O |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 6-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-17-(5-methyl-2-pyridinyl)-1,5,7,9,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-3,5,7,9,11,13,15-heptaen-2-one |
| SMILES | Cc1ccc(-n2c3ccccc3c3nc4nc(Nc5ccc(N6CCN(C)CC6)c(C)c5)ncc4c(=O)n32)nc1 |
| InChI | InChI=1S/C30H29N9O/c1-19-8-11-26(31-17-19)38-25-7-5-4-6-22(25)28-34-27-23(29(40)39(28)38)18-32-30(35-27)33-21-9-10-24(20(2)16-21)37-14-12-36(3)13-15-37/h4-11,16-18H,12-15H2,1-3H3,(H,32,33,35) |
| InChIKey | OPZIQZWJGSEARS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|