C23H24N6S — CID 155559716
4-N-(1,3-benzothiazol-2-yl)-5-methyl-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 155559716) has the molecular formula C23H24N6S and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-5-methyl-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-5-methyl-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155559716 |
| Molecular Formula | C23H24N6S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-5-methyl-2-N-(4-piperidin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc(N3CCCCC3)cc2)nc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H24N6S/c1-16-15-24-22(25-17-9-11-18(12-10-17)29-13-5-2-6-14-29)27-21(16)28-23-26-19-7-3-4-8-20(19)30-23/h3-4,7-12,15H,2,5-6,13-14H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | GEJKIFCDSKSZMS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|