C30H31ClN7O3+ — CID 130472884
N-[2-[(1-acetylpiperazin-1-ium-1-yl)methoxy]-5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 130472884) has the molecular formula C30H31ClN7O3+ and a molecular weight of 573.08 g/mol. Its IUPAC name is N-[2-[(1-acetylpiperazin-1-ium-1-yl)methoxy]-5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[(1-acetylpiperazin-1-ium-1-yl)methoxy]-5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130472884 |
| Molecular Formula | C30H31ClN7O3+ |
| Molecular Weight | 573.08 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | N-[2-[(1-acetylpiperazin-1-ium-1-yl)methoxy]-5-[[5-chloro-4-(naphthalen-2-ylamino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2ncc(Cl)c(Nc3ccc4ccccc4c3)n2)ccc1OC[N+]1(C(C)=O)CCNCC1 |
| InChI | InChI=1S/C30H30ClN7O3/c1-3-28(40)36-26-17-24(10-11-27(26)41-19-38(20(2)39)14-12-32-13-15-38)35-30-33-18-25(31)29(37-30)34-23-9-8-21-6-4-5-7-22(21)16-23/h3-11,16-18,32H,1,12-15,19H2,2H3,(H2-,33,34,35,36,37,40)/p+1 |
| InChIKey | GVBIHHGTQJMDSD-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.08 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|