C19H15Cl3N6O2 — CID 90331525
N-[5-chloro-2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 90331525) has the molecular formula C19H15Cl3N6O2 and a molecular weight of 465.73 g/mol. Its IUPAC name is N-[5-chloro-2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[5-chloro-2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90331525 |
| Molecular Formula | C19H15Cl3N6O2 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | N-[5-chloro-2-[[5-chloro-2-[(2-chloro-6-methoxy-4-pyridinyl)amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Cl)ccc1Nc1nc(Nc2cc(Cl)nc(OC)c2)ncc1Cl |
| InChI | InChI=1S/C19H15Cl3N6O2/c1-3-16(29)25-14-6-10(20)4-5-13(14)26-18-12(21)9-23-19(28-18)24-11-7-15(22)27-17(8-11)30-2/h3-9H,1H2,2H3,(H,25,29)(H2,23,24,26,27,28) |
| InChIKey | YOUUCKGTDJYARS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|