C20H22ClFN6O2 — CID 90331578
3-[[5-chloro-4-[4-fluoro-2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 90331578) has the molecular formula C20H22ClFN6O2 and a molecular weight of 432.89 g/mol. Its IUPAC name is 3-[[5-chloro-4-[4-fluoro-2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | 3-[[5-chloro-4-[4-fluoro-2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90331578 |
| Molecular Formula | C20H22ClFN6O2 |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 3-[[5-chloro-4-[4-fluoro-2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | C=CC(=O)Nc1cc(F)ccc1Nc1nc(NC2CCCC(C(N)=O)C2)ncc1Cl |
| InChI | InChI=1S/C20H22ClFN6O2/c1-2-17(29)26-16-9-12(22)6-7-15(16)27-19-14(21)10-24-20(28-19)25-13-5-3-4-11(8-13)18(23)30/h2,6-7,9-11,13H,1,3-5,8H2,(H2,23,30)(H,26,29)(H2,24,25,27,28) |
| InChIKey | QVGJLHOVWKXNTF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|