C21H24ClFN6O2 — CID 90331174
cis-(1R,3S)-3-[[4-[2-[[(E)-but-2-enoyl]amino]-4-fluoroanilino]-5-chloropyrimidin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 90331174) has the molecular formula C21H24ClFN6O2 and a molecular weight of 446.91 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[4-[2-[[(E)-but-2-enoyl]amino]-4-fluoroanilino]-5-chloropyrimidin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-3-[[4-[2-[[(E)-but-2-enoyl]amino]-4-fluoroanilino]-5-chloropyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90331174 |
| Molecular Formula | C21H24ClFN6O2 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | cis-(1R,3S)-3-[[4-[2-[[(E)-but-2-enoyl]amino]-4-fluoroanilino]-5-chloropyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | C/C=C/C(=O)Nc1cc(F)ccc1Nc1nc(N[C@H]2CCC[C@@H](C(N)=O)C2)ncc1Cl |
| InChI | InChI=1S/C21H24ClFN6O2/c1-2-4-18(30)27-17-10-13(23)7-8-16(17)28-20-15(22)11-25-21(29-20)26-14-6-3-5-12(9-14)19(24)31/h2,4,7-8,10-12,14H,3,5-6,9H2,1H3,(H2,24,31)(H,27,30)(H2,25,26,28,29)/b4-2+/t12-,14+/m1/s1 |
| InChIKey | GALCBZMCWCNCRR-LDVDSAPTSA-N |
| XLogP | 3.98 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|