C22H27ClN6O4 — CID 90331572
3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-N-(2-hydroxyethoxy)cyclohexane-1-carboxamide (PubChem CID 90331572) has the molecular formula C22H27ClN6O4 and a molecular weight of 474.95 g/mol. Its IUPAC name is 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-N-(2-hydroxyethoxy)cyclohexane-1-carboxamide.
| Compound Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-N-(2-hydroxyethoxy)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90331572 |
| Molecular Formula | C22H27ClN6O4 |
| Molecular Weight | 474.95 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-N-(2-hydroxyethoxy)cyclohexane-1-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(NC2CCCC(C(=O)NOCCO)C2)ncc1Cl |
| InChI | InChI=1S/C22H27ClN6O4/c1-2-19(31)26-17-8-3-4-9-18(17)27-20-16(23)13-24-22(28-20)25-15-7-5-6-14(12-15)21(32)29-33-11-10-30/h2-4,8-9,13-15,30H,1,5-7,10-12H2,(H,26,31)(H,29,32)(H2,24,25,27,28) |
| InChIKey | HXXBOXYZRRNJQI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 137.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|