C23H20ClN7O4 — CID 90331209
3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-cyano-N-(2-hydroxyethoxy)benzamide (PubChem CID 90331209) has the molecular formula C23H20ClN7O4 and a molecular weight of 493.91 g/mol. Its IUPAC name is 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-cyano-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-cyano-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 90331209 |
| Molecular Formula | C23H20ClN7O4 |
| Molecular Weight | 493.91 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 3-[[5-chloro-4-[2-(prop-2-enoylamino)anilino]pyrimidin-2-yl]amino]-4-cyano-N-(2-hydroxyethoxy)benzamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2cc(C(=O)NOCCO)ccc2C#N)ncc1Cl |
| InChI | InChI=1S/C23H20ClN7O4/c1-2-20(33)27-17-5-3-4-6-18(17)28-21-16(24)13-26-23(30-21)29-19-11-14(7-8-15(19)12-25)22(34)31-35-10-9-32/h2-8,11,13,32H,1,9-10H2,(H,27,33)(H,31,34)(H2,26,28,29,30) |
| InChIKey | SMEKINYTMMOFFB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 161.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|