C22H29ClN6O2 — CID 146516005
N-[2-[[5-chloro-2-[[(3S)-1-(1-hydroxy-2-methylpropyl)piperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 146516005) has the molecular formula C22H29ClN6O2 and a molecular weight of 444.97 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[[(3S)-1-(1-hydroxy-2-methylpropyl)piperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-[[(3S)-1-(1-hydroxy-2-methylpropyl)piperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146516005 |
| Molecular Formula | C22H29ClN6O2 |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[2-[[5-chloro-2-[[(3S)-1-(1-hydroxy-2-methylpropyl)piperidin-3-yl]amino]pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(N[C@H]2CCCN(C(O)C(C)C)C2)ncc1Cl |
| InChI | InChI=1S/C22H29ClN6O2/c1-4-19(30)26-17-9-5-6-10-18(17)27-20-16(23)12-24-22(28-20)25-15-8-7-11-29(13-15)21(31)14(2)3/h4-6,9-10,12,14-15,21,31H,1,7-8,11,13H2,2-3H3,(H,26,30)(H2,24,25,27,28)/t15-,21?/m0/s1 |
| InChIKey | ODWWNQMVTZYCIK-ZDGMYTEDSA-N |
| XLogP | 3.85 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|