C22H26ClN5O3 — CID 118966095
N-[2-[[5-chloro-2-[[(3S)-1-[(2S)-2-hydroxypropanoyl]piperidin-3-yl]amino]pyrimidin-4-yl]methyl]phenyl]prop-2-enamide (PubChem CID 118966095) has the molecular formula C22H26ClN5O3 and a molecular weight of 443.94 g/mol. Its IUPAC name is N-[2-[[5-chloro-2-[[(3S)-1-[(2S)-2-hydroxypropanoyl]piperidin-3-yl]amino]pyrimidin-4-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-chloro-2-[[(3S)-1-[(2S)-2-hydroxypropanoyl]piperidin-3-yl]amino]pyrimidin-4-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118966095 |
| Molecular Formula | C22H26ClN5O3 |
| Molecular Weight | 443.94 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-[2-[[5-chloro-2-[[(3S)-1-[(2S)-2-hydroxypropanoyl]piperidin-3-yl]amino]pyrimidin-4-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Cc1nc(N[C@H]2CCCN(C(=O)[C@H](C)O)C2)ncc1Cl |
| InChI | InChI=1S/C22H26ClN5O3/c1-3-20(30)26-18-9-5-4-7-15(18)11-19-17(23)12-24-22(27-19)25-16-8-6-10-28(13-16)21(31)14(2)29/h3-5,7,9,12,14,16,29H,1,6,8,10-11,13H2,2H3,(H,26,30)(H,24,25,27)/t14-,16-/m0/s1 |
| InChIKey | SUSUGJFEVPXKGY-HOCLYGCPSA-N |
| XLogP | 2.63 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.94 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|