C22H27N5O2 — CID 129129610
N-[2-[[2-[[(1S)-3-acetylcyclohexyl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide (PubChem CID 129129610) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[2-[[2-[[(1S)-3-acetylcyclohexyl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[2-[[(1S)-3-acetylcyclohexyl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 129129610 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-[2-[[2-[[(1S)-3-acetylcyclohexyl]amino]-5-methylpyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(N[C@H]2CCCC(C(C)=O)C2)ncc1C |
| InChI | InChI=1S/C22H27N5O2/c1-4-20(29)25-18-10-5-6-11-19(18)26-21-14(2)13-23-22(27-21)24-17-9-7-8-16(12-17)15(3)28/h4-6,10-11,13,16-17H,1,7-9,12H2,2-3H3,(H,25,29)(H2,23,24,26,27)/t16?,17-/m0/s1 |
| InChIKey | MPSZLDJWNKOJDZ-DJNXLDHESA-N |
| XLogP | 4.21 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|