C34H32F3N7O6 — CID 145293912
5-[3-[[5-[[2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]pyrimidin-2-yl]amino]anilino]-5-oxopentanoic acid;prop-2-enamide (PubChem CID 145293912) has the molecular formula C34H32F3N7O6 and a molecular weight of 691.67 g/mol. Its IUPAC name is 5-[3-[[5-[[2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]pyrimidin-2-yl]amino]anilino]-5-oxopentanoic acid;prop-2-enamide.
| Compound Name | 5-[3-[[5-[[2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]pyrimidin-2-yl]amino]anilino]-5-oxopentanoic acid;prop-2-enamide |
|---|---|
| PubChem CID | 145293912 |
| Molecular Formula | C34H32F3N7O6 |
| Molecular Weight | 691.67 g/mol |
| Exact Mass | 691.24 |
| IUPAC Name | 5-[3-[[5-[[2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzoyl]amino]pyrimidin-2-yl]amino]anilino]-5-oxopentanoic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.Cc1ccc(NC(=O)c2cccc(C(F)(F)F)c2)cc1C(=O)Nc1cnc(Nc2cccc(NC(=O)CCCC(=O)O)c2)nc1 |
| InChI | InChI=1S/C31H27F3N6O5.C3H5NO/c1-18-11-12-23(38-28(44)19-5-2-6-20(13-19)31(32,33)34)15-25(18)29(45)39-24-16-35-30(36-17-24)40-22-8-3-7-21(14-22)37-26(41)9-4-10-27(42)43;1-2-3(4)5/h2-3,5-8,11-17H,4,9-10H2,1H3,(H,37,41)(H,38,44)(H,39,45)(H,42,43)(H,35,36,40);2H,1H2,(H2,4,5) |
| InChIKey | VIZBBLQSGKMVSL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 205.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|