C38H34F3N7O4 — CID 145293879
N-[2-[3-[[(2S)-2-(1-hydroxyprop-2-enylamino)-3-phenylpropanoyl]amino]anilino]pyrimidin-5-yl]-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 145293879) has the molecular formula C38H34F3N7O4 and a molecular weight of 709.73 g/mol. Its IUPAC name is N-[2-[3-[[(2S)-2-(1-hydroxyprop-2-enylamino)-3-phenylpropanoyl]amino]anilino]pyrimidin-5-yl]-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | N-[2-[3-[[(2S)-2-(1-hydroxyprop-2-enylamino)-3-phenylpropanoyl]amino]anilino]pyrimidin-5-yl]-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 145293879 |
| Molecular Formula | C38H34F3N7O4 |
| Molecular Weight | 709.73 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | N-[2-[3-[[(2S)-2-(1-hydroxyprop-2-enylamino)-3-phenylpropanoyl]amino]anilino]pyrimidin-5-yl]-2-methyl-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | C=CC(O)N[C@@H](Cc1ccccc1)C(=O)Nc1cccc(Nc2ncc(NC(=O)c3cc(NC(=O)c4cccc(C(F)(F)F)c4)ccc3C)cn2)c1 |
| InChI | InChI=1S/C38H34F3N7O4/c1-3-33(49)48-32(17-24-9-5-4-6-10-24)36(52)45-27-13-8-14-28(19-27)47-37-42-21-30(22-43-37)46-35(51)31-20-29(16-15-23(31)2)44-34(50)25-11-7-12-26(18-25)38(39,40)41/h3-16,18-22,32-33,48-49H,1,17H2,2H3,(H,44,50)(H,45,52)(H,46,51)(H,42,43,47)/t32-,33?/m0/s1 |
| InChIKey | YYKSLEKVXQYCDH-JEFWXSHNSA-N |
| XLogP | 6.70 |
| TPSA | 157.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.73 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|