C27H27N7O2 — CID 71556057
N-[2-(3-aminoanilino)pyrimidin-5-yl]-5-[[3-(dimethylamino)benzoyl]amino]-2-methylbenzamide (PubChem CID 71556057) has the molecular formula C27H27N7O2 and a molecular weight of 481.56 g/mol. Its IUPAC name is N-[2-(3-aminoanilino)pyrimidin-5-yl]-5-[[3-(dimethylamino)benzoyl]amino]-2-methylbenzamide.
| Compound Name | N-[2-(3-aminoanilino)pyrimidin-5-yl]-5-[[3-(dimethylamino)benzoyl]amino]-2-methylbenzamide |
|---|---|
| PubChem CID | 71556057 |
| Molecular Formula | C27H27N7O2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[2-(3-aminoanilino)pyrimidin-5-yl]-5-[[3-(dimethylamino)benzoyl]amino]-2-methylbenzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(N(C)C)c2)cc1C(=O)Nc1cnc(Nc2cccc(N)c2)nc1 |
| InChI | InChI=1S/C27H27N7O2/c1-17-10-11-21(31-25(35)18-6-4-9-23(12-18)34(2)3)14-24(17)26(36)32-22-15-29-27(30-16-22)33-20-8-5-7-19(28)13-20/h4-16H,28H2,1-3H3,(H,31,35)(H,32,36)(H,29,30,33) |
| InChIKey | HWJIIEJFMNBVDL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 125.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|