C25H21ClN6O2 — CID 131990534
N-[2-(3-aminoanilino)pyrimidin-5-yl]-2-chloro-5-[(3-methylbenzoyl)amino]benzamide (PubChem CID 131990534) has the molecular formula C25H21ClN6O2 and a molecular weight of 472.94 g/mol. Its IUPAC name is N-[2-(3-aminoanilino)pyrimidin-5-yl]-2-chloro-5-[(3-methylbenzoyl)amino]benzamide.
| Compound Name | N-[2-(3-aminoanilino)pyrimidin-5-yl]-2-chloro-5-[(3-methylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 131990534 |
| Molecular Formula | C25H21ClN6O2 |
| Molecular Weight | 472.94 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[2-(3-aminoanilino)pyrimidin-5-yl]-2-chloro-5-[(3-methylbenzoyl)amino]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(Cl)c(C(=O)Nc3cnc(Nc4cccc(N)c4)nc3)c2)c1 |
| InChI | InChI=1S/C25H21ClN6O2/c1-15-4-2-5-16(10-15)23(33)30-19-8-9-22(26)21(12-19)24(34)31-20-13-28-25(29-14-20)32-18-7-3-6-17(27)11-18/h2-14H,27H2,1H3,(H,30,33)(H,31,34)(H,28,29,32) |
| InChIKey | WAWSNIIRMOUPNR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|