C32H33ClN6O2S — CID 143609709
2-chloro-5-[(3-methylbenzoyl)amino]-N-[2-[4-(3-pyrrolidin-1-ylpropylsulfanyl)anilino]pyrimidin-5-yl]benzamide (PubChem CID 143609709) has the molecular formula C32H33ClN6O2S and a molecular weight of 601.18 g/mol. Its IUPAC name is 2-chloro-5-[(3-methylbenzoyl)amino]-N-[2-[4-(3-pyrrolidin-1-ylpropylsulfanyl)anilino]pyrimidin-5-yl]benzamide.
| Compound Name | 2-chloro-5-[(3-methylbenzoyl)amino]-N-[2-[4-(3-pyrrolidin-1-ylpropylsulfanyl)anilino]pyrimidin-5-yl]benzamide |
|---|---|
| PubChem CID | 143609709 |
| Molecular Formula | C32H33ClN6O2S |
| Molecular Weight | 601.18 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 2-chloro-5-[(3-methylbenzoyl)amino]-N-[2-[4-(3-pyrrolidin-1-ylpropylsulfanyl)anilino]pyrimidin-5-yl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(Cl)c(C(=O)Nc3cnc(Nc4ccc(SCCCN5CCCC5)cc4)nc3)c2)c1 |
| InChI | InChI=1S/C32H33ClN6O2S/c1-22-6-4-7-23(18-22)30(40)36-25-10-13-29(33)28(19-25)31(41)37-26-20-34-32(35-21-26)38-24-8-11-27(12-9-24)42-17-5-16-39-14-2-3-15-39/h4,6-13,18-21H,2-3,5,14-17H2,1H3,(H,36,40)(H,37,41)(H,34,35,38) |
| InChIKey | FNDHNFSNADIMFE-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.18 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|