C29H25ClF3N5O4 — CID 143609632
N-(4-chloro-3-formylphenyl)-3-(trifluoromethyl)benzamide;ethyl 3-[[5-(methylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 143609632) has the molecular formula C29H25ClF3N5O4 and a molecular weight of 600.00 g/mol. Its IUPAC name is N-(4-chloro-3-formylphenyl)-3-(trifluoromethyl)benzamide;ethyl 3-[[5-(methylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | N-(4-chloro-3-formylphenyl)-3-(trifluoromethyl)benzamide;ethyl 3-[[5-(methylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 143609632 |
| Molecular Formula | C29H25ClF3N5O4 |
| Molecular Weight | 600.00 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | N-(4-chloro-3-formylphenyl)-3-(trifluoromethyl)benzamide;ethyl 3-[[5-(methylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncc(NC)cn2)c1.O=Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1Cl |
| InChI | InChI=1S/C15H9ClF3NO2.C14H16N4O2/c16-13-5-4-12(7-10(13)8-21)20-14(22)9-2-1-3-11(6-9)15(17,18)19;1-3-20-13(19)10-5-4-6-11(7-10)18-14-16-8-12(15-2)9-17-14/h1-8H,(H,20,22);4-9,15H,3H2,1-2H3,(H,16,17,18) |
| InChIKey | ZNMPYOFHCLIHNZ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.00 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|