C26H18ClF3N4O3 — CID 123289085
N-[4-chloro-3-[2-[2-(4-hydroxyanilino)pyrimidin-5-yl]acetyl]phenyl]-3-(trifluoromethyl)benzamide (PubChem CID 123289085) has the molecular formula C26H18ClF3N4O3 and a molecular weight of 526.90 g/mol. Its IUPAC name is N-[4-chloro-3-[2-[2-(4-hydroxyanilino)pyrimidin-5-yl]acetyl]phenyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[4-chloro-3-[2-[2-(4-hydroxyanilino)pyrimidin-5-yl]acetyl]phenyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 123289085 |
| Molecular Formula | C26H18ClF3N4O3 |
| Molecular Weight | 526.90 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | N-[4-chloro-3-[2-[2-(4-hydroxyanilino)pyrimidin-5-yl]acetyl]phenyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(=O)Cc2cnc(Nc3ccc(O)cc3)nc2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H18ClF3N4O3/c27-22-9-6-19(33-24(37)16-2-1-3-17(11-16)26(28,29)30)12-21(22)23(36)10-15-13-31-25(32-14-15)34-18-4-7-20(35)8-5-18/h1-9,11-14,35H,10H2,(H,33,37)(H,31,32,34) |
| InChIKey | AZDZQAUMNFSROU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|