C25H26FN5O2 — CID 123730901
1-[8-[[2-(4-ethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]prop-2-en-1-one (PubChem CID 123730901) has the molecular formula C25H26FN5O2 and a molecular weight of 447.51 g/mol. Its IUPAC name is 1-[8-[[2-(4-ethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[8-[[2-(4-ethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123730901 |
| Molecular Formula | C25H26FN5O2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 1-[8-[[2-(4-ethoxyanilino)-5-fluoropyrimidin-4-yl]amino]-2,3,4,5-tetrahydro-1-benzazepin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCc2ccc(Nc3nc(Nc4ccc(OCC)cc4)ncc3F)cc21 |
| InChI | InChI=1S/C25H26FN5O2/c1-3-23(32)31-14-6-5-7-17-8-9-19(15-22(17)31)28-24-21(26)16-27-25(30-24)29-18-10-12-20(13-11-18)33-4-2/h3,8-13,15-16H,1,4-7,14H2,2H3,(H2,27,28,29,30) |
| InChIKey | DEUONROQILIELJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|