C26H27ClFN5O3 — CID 118507386
2-chloro-1-[7-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]spiro[2,4-dihydroquinoline-3,1'-cyclopropane]-1-yl]ethanone (PubChem CID 118507386) has the molecular formula C26H27ClFN5O3 and a molecular weight of 511.99 g/mol. Its IUPAC name is 2-chloro-1-[7-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]spiro[2,4-dihydroquinoline-3,1'-cyclopropane]-1-yl]ethanone.
| Compound Name | 2-chloro-1-[7-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]spiro[2,4-dihydroquinoline-3,1'-cyclopropane]-1-yl]ethanone |
|---|---|
| PubChem CID | 118507386 |
| Molecular Formula | C26H27ClFN5O3 |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | 2-chloro-1-[7-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]spiro[2,4-dihydroquinoline-3,1'-cyclopropane]-1-yl]ethanone |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3ccc4c(c3)N(C(=O)CCl)CC3(CC3)C4)n2)cc1 |
| InChI | InChI=1S/C26H27ClFN5O3/c1-35-10-11-36-20-6-4-18(5-7-20)31-25-29-15-21(28)24(32-25)30-19-3-2-17-13-26(8-9-26)16-33(22(17)12-19)23(34)14-27/h2-7,12,15H,8-11,13-14,16H2,1H3,(H2,29,30,31,32) |
| InChIKey | JHBOLFNMAHCUQU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|