C25H19F6N5O4S — CID 155578495
2,3,4,5,6-pentafluoro-N-[4-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide (PubChem CID 155578495) has the molecular formula C25H19F6N5O4S and a molecular weight of 599.51 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 155578495 |
| Molecular Formula | C25H19F6N5O4S |
| Molecular Weight | 599.51 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-[[5-fluoro-2-[4-(2-methoxyethoxy)anilino]pyrimidin-4-yl]amino]phenyl]benzenesulfonamide |
| SMILES | COCCOc1ccc(Nc2ncc(F)c(Nc3ccc(NS(=O)(=O)c4c(F)c(F)c(F)c(F)c4F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H19F6N5O4S/c1-39-10-11-40-16-8-6-14(7-9-16)34-25-32-12-17(26)24(35-25)33-13-2-4-15(5-3-13)36-41(37,38)23-21(30)19(28)18(27)20(29)22(23)31/h2-9,12,36H,10-11H2,1H3,(H2,32,33,34,35) |
| InChIKey | GTYJGRMQBDNEBK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|