C20H17FN4OS — CID 89205381
5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylbenzenethiol (PubChem CID 89205381) has the molecular formula C20H17FN4OS and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylbenzenethiol.
| Compound Name | 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylbenzenethiol |
|---|---|
| PubChem CID | 89205381 |
| Molecular Formula | C20H17FN4OS |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylbenzenethiol |
| SMILES | C#CCOc1ccc(Nc2nc(Nc3ccc(C)c(S)c3)ncc2F)cc1 |
| InChI | InChI=1S/C20H17FN4OS/c1-3-10-26-16-8-6-14(7-9-16)23-19-17(21)12-22-20(25-19)24-15-5-4-13(2)18(27)11-15/h1,4-9,11-12,27H,10H2,2H3,(H2,22,23,24,25) |
| InChIKey | ICROMUVZLFACPU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|