C29H36FN9O6S — CID 50916334
2-amino-5-(diaminomethylideneamino)pentanoic acid;N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide (PubChem CID 50916334) has the molecular formula C29H36FN9O6S and a molecular weight of 657.73 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide |
|---|---|
| PubChem CID | 50916334 |
| Molecular Formula | C29H36FN9O6S |
| Molecular Weight | 657.73 g/mol |
| Exact Mass | 657.25 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide |
| SMILES | C#CCOc1ccc(Nc2nc(Nc3ccc(C)c(S(=O)(=O)NC(=O)CC)c3)ncc2F)cc1.NC(N)=NCCCC(N)C(=O)O |
| InChI | InChI=1S/C23H22FN5O4S.C6H14N4O2/c1-4-12-33-18-10-8-16(9-11-18)26-22-19(24)14-25-23(28-22)27-17-7-6-15(3)20(13-17)34(31,32)29-21(30)5-2;7-4(5(11)12)2-1-3-10-6(8)9/h1,6-11,13-14H,5,12H2,2-3H3,(H,29,30)(H2,25,26,27,28);4H,1-3,7H2,(H,11,12)(H4,8,9,10) |
| InChIKey | GSCUZFYULSOPFL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 250.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|