C28H27FN6O4 — CID 25071615
5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)-1-benzofuran-2-carboxamide (PubChem CID 25071615) has the molecular formula C28H27FN6O4 and a molecular weight of 530.56 g/mol. Its IUPAC name is 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 25071615 |
| Molecular Formula | C28H27FN6O4 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-N-(2-morpholin-4-ylethyl)-1-benzofuran-2-carboxamide |
| SMILES | C#CCOc1ccc(Nc2nc(Nc3ccc4oc(C(=O)NCCN5CCOCC5)cc4c3)ncc2F)cc1 |
| InChI | InChI=1S/C28H27FN6O4/c1-2-13-38-22-6-3-20(4-7-22)32-26-23(29)18-31-28(34-26)33-21-5-8-24-19(16-21)17-25(39-24)27(36)30-9-10-35-11-14-37-15-12-35/h1,3-8,16-18H,9-15H2,(H,30,36)(H2,31,32,33,34) |
| InChIKey | UWGYDELDQNQURY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|