C23H22FN5O4S — CID 159324500
1-[5-[[5-fluoro-4-[4-(isocyanomethoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylbutan-2-one (PubChem CID 159324500) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is 1-[5-[[5-fluoro-4-[4-(isocyanomethoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylbutan-2-one.
| Compound Name | 1-[5-[[5-fluoro-4-[4-(isocyanomethoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylbutan-2-one |
|---|---|
| PubChem CID | 159324500 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-[5-[[5-fluoro-4-[4-(isocyanomethoxy)anilino]pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylbutan-2-one |
| SMILES | [C-]#[N+]COc1ccc(Nc2nc(Nc3ccc(C)c(S(=O)(=O)CC(=O)CC)c3)ncc2F)cc1 |
| InChI | InChI=1S/C23H22FN5O4S/c1-4-18(30)13-34(31,32)21-11-17(6-5-15(21)2)28-23-26-12-20(24)22(29-23)27-16-7-9-19(10-8-16)33-14-25-3/h5-12H,4,13-14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | JFBXKNXXDRGJIE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|