C28H27FN6O2S — CID 155553418
2-[3-[(2-fluorobenzoyl)amino]phenyl]-4-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazole-5-carboxamide (PubChem CID 155553418) has the molecular formula C28H27FN6O2S and a molecular weight of 530.63 g/mol. Its IUPAC name is 2-[3-[(2-fluorobenzoyl)amino]phenyl]-4-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[3-[(2-fluorobenzoyl)amino]phenyl]-4-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155553418 |
| Molecular Formula | C28H27FN6O2S |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 2-[3-[(2-fluorobenzoyl)amino]phenyl]-4-[4-(4-methylpiperazin-1-yl)anilino]-1,3-thiazole-5-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3nc(-c4cccc(NC(=O)c5ccccc5F)c4)sc3C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C28H27FN6O2S/c1-34-13-15-35(16-14-34)21-11-9-19(10-12-21)31-26-24(25(30)36)38-28(33-26)18-5-4-6-20(17-18)32-27(37)22-7-2-3-8-23(22)29/h2-12,17,31H,13-16H2,1H3,(H2,30,36)(H,32,37) |
| InChIKey | RMJVAANWVYDHEU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|