C19H23N5O — CID 162352566
(E)-3-[3-[4-(4-methylpiperazin-1-yl)anilino]-4-pyridinyl]prop-2-enamide (PubChem CID 162352566) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (E)-3-[3-[4-(4-methylpiperazin-1-yl)anilino]-4-pyridinyl]prop-2-enamide.
| Compound Name | (E)-3-[3-[4-(4-methylpiperazin-1-yl)anilino]-4-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 162352566 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (E)-3-[3-[4-(4-methylpiperazin-1-yl)anilino]-4-pyridinyl]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(Nc3cnccc3/C=C/C(N)=O)cc2)CC1 |
| InChI | InChI=1S/C19H23N5O/c1-23-10-12-24(13-11-23)17-5-3-16(4-6-17)22-18-14-21-9-8-15(18)2-7-19(20)25/h2-9,14,22H,10-13H2,1H3,(H2,20,25)/b7-2+ |
| InChIKey | IPPQCUZLXVJJMR-FARCUNLSSA-N |
| XLogP | 2.08 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|